C27H20O11 — CID 75492356
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 75492356) has the molecular formula C27H20O11 and a molecular weight of 520.45 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 75492356 |
| Molecular Formula | C27H20O11 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1cc(C2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)cc2c1OCCO2 |
| InChI | InChI=1S/C27H20O11/c1-34-18-7-12(8-19-26(18)36-5-4-35-19)13-9-20(31)37-17-10-16(30)22-23(32)24(33)25(38-27(22)21(13)17)11-2-3-14(28)15(29)6-11/h2-3,6-8,10,13,28-30,33H,4-5,9H2,1H3 |
| InChIKey | YLHHCCBVNKFBIW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|