C30H24N2O10 — CID 91638017
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-[3-methoxy-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 91638017) has the molecular formula C30H24N2O10 and a molecular weight of 572.53 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-[3-methoxy-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-[3-methoxy-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 91638017 |
| Molecular Formula | C30H24N2O10 |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-[3-methoxy-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1cc(C2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)ccc1OCc1nccn1C |
| InChI | InChI=1S/C30H24N2O10/c1-32-8-7-31-23(32)13-40-20-6-4-14(10-21(20)39-2)16-11-24(36)41-22-12-19(35)26-27(37)28(38)29(42-30(26)25(16)22)15-3-5-17(33)18(34)9-15/h3-10,12,16,33-35,38H,11,13H2,1-2H3 |
| InChIKey | LYDWVWKNPUIXJB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 173.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|