C26H20O8 — CID 97489165
(10R)-2-(3,4-dihydroxyphenyl)-10-(3,4-dimethylphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97489165) has the molecular formula C26H20O8 and a molecular weight of 460.44 g/mol. Its IUPAC name is (10R)-2-(3,4-dihydroxyphenyl)-10-(3,4-dimethylphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-2-(3,4-dihydroxyphenyl)-10-(3,4-dimethylphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97489165 |
| Molecular Formula | C26H20O8 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (10R)-2-(3,4-dihydroxyphenyl)-10-(3,4-dimethylphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | Cc1ccc([C@H]2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)cc1C |
| InChI | InChI=1S/C26H20O8/c1-11-3-4-13(7-12(11)2)15-9-20(30)33-19-10-18(29)22-23(31)24(32)25(34-26(22)21(15)19)14-5-6-16(27)17(28)8-14/h3-8,10,15,27-29,32H,9H2,1-2H3/t15-/m1/s1 |
| InChIKey | KZMJIFPFKIZZNL-OAHLLOKOSA-N |
| XLogP | 4.34 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|