C26H20O10 — CID 97488033
(10R)-2-(3,4-dihydroxyphenyl)-10-(3,4-dimethoxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97488033) has the molecular formula C26H20O10 and a molecular weight of 492.44 g/mol. Its IUPAC name is (10R)-2-(3,4-dihydroxyphenyl)-10-(3,4-dimethoxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-2-(3,4-dihydroxyphenyl)-10-(3,4-dimethoxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97488033 |
| Molecular Formula | C26H20O10 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | (10R)-2-(3,4-dihydroxyphenyl)-10-(3,4-dimethoxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc([C@H]2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)cc1OC |
| InChI | InChI=1S/C26H20O10/c1-33-17-6-4-11(8-18(17)34-2)13-9-20(30)35-19-10-16(29)22-23(31)24(32)25(36-26(22)21(13)19)12-3-5-14(27)15(28)7-12/h3-8,10,13,27-29,32H,9H2,1-2H3/t13-/m1/s1 |
| InChIKey | DCDGWDFLENLRIY-CYBMUJFWSA-N |
| XLogP | 3.74 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|