C25H18O9 — CID 97489109
(10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97489109) has the molecular formula C25H18O9 and a molecular weight of 462.41 g/mol. Its IUPAC name is (10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97489109 |
| Molecular Formula | C25H18O9 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)cc1 |
| InChI | InChI=1S/C25H18O9/c1-32-13-5-2-11(3-6-13)14-9-19(29)33-18-10-17(28)21-22(30)23(31)24(34-25(21)20(14)18)12-4-7-15(26)16(27)8-12/h2-8,10,14,26-28,31H,9H2,1H3/t14-/m0/s1 |
| InChIKey | HLXMXCUBPFOGMH-AWEZNQCLSA-N |
| XLogP | 3.73 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|