C33H26O10 — CID 99984111
(10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 99984111) has the molecular formula C33H26O10 and a molecular weight of 582.56 g/mol. Its IUPAC name is (10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 99984111 |
| Molecular Formula | C33H26O10 |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.15 |
| IUPAC Name | (10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(CCOc2ccccc2[C@@H]2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)cc1 |
| InChI | InChI=1S/C33H26O10/c1-40-19-9-6-17(7-10-19)12-13-41-25-5-3-2-4-20(25)21-15-27(37)42-26-16-24(36)29-30(38)31(39)32(43-33(29)28(21)26)18-8-11-22(34)23(35)14-18/h2-11,14,16,21,34-36,39H,12-13,15H2,1H3/t21-/m0/s1 |
| InChIKey | HHJWNBIIERKBMK-NRFANRHFSA-N |
| XLogP | 5.35 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|