C26H18O11 — CID 97488284
2-[2-[(10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetic acid (PubChem CID 97488284) has the molecular formula C26H18O11 and a molecular weight of 506.42 g/mol. Its IUPAC name is 2-[2-[(10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 97488284 |
| Molecular Formula | C26H18O11 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-[2-[(10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1[C@H]1CC(=O)Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c21 |
| InChI | InChI=1S/C26H18O11/c27-14-6-5-11(7-15(14)28)25-24(34)23(33)22-16(29)9-18-21(26(22)37-25)13(8-20(32)36-18)12-3-1-2-4-17(12)35-10-19(30)31/h1-7,9,13,27-29,34H,8,10H2,(H,30,31)/t13-/m1/s1 |
| InChIKey | FWDOTPMBXZPVHK-CYBMUJFWSA-N |
| XLogP | 3.19 |
| TPSA | 183.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|