C24H15NO10 — CID 97488021
(10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-nitrophenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97488021) has the molecular formula C24H15NO10 and a molecular weight of 477.38 g/mol. Its IUPAC name is (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-nitrophenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-nitrophenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97488021 |
| Molecular Formula | C24H15NO10 |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-nitrophenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@H](c2ccccc2[N+](=O)[O-])c2c(cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc23)O1 |
| InChI | InChI=1S/C24H15NO10/c26-14-6-5-10(7-15(14)27)23-22(31)21(30)20-16(28)9-17-19(24(20)35-23)12(8-18(29)34-17)11-3-1-2-4-13(11)25(32)33/h1-7,9,12,26-28,31H,8H2/t12-/m1/s1 |
| InChIKey | DTJASHIVIOOMEP-GFCCVEGCSA-N |
| XLogP | 3.63 |
| TPSA | 180.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|