C21H18O8 — CID 91636900
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-propan-2-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 91636900) has the molecular formula C21H18O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-propan-2-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-propan-2-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 91636900 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-propan-2-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CC(C)C1CC(=O)Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c21 |
| InChI | InChI=1S/C21H18O8/c1-8(2)10-6-15(25)28-14-7-13(24)17-18(26)19(27)20(29-21(17)16(10)14)9-3-4-11(22)12(23)5-9/h3-5,7-8,10,22-24,27H,6H2,1-2H3 |
| InChIKey | JSFBMSDYISFMTG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|