C22H20O8 — CID 99986371
(10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-methylpropyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 99986371) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-methylpropyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-methylpropyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 99986371 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(2-methylpropyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CC(C)C[C@@H]1CC(=O)Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c21 |
| InChI | InChI=1S/C22H20O8/c1-9(2)5-11-7-16(26)29-15-8-14(25)18-19(27)20(28)21(30-22(18)17(11)15)10-3-4-12(23)13(24)6-10/h3-4,6,8-9,11,23-25,28H,5,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | PPBDTMYBEGSWSJ-LLVKDONJSA-N |
| XLogP | 3.72 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|