C24H18O10 — CID 58307662
(10S)-10-(3,4-dihydroxycyclohexa-2,4-dien-1-yl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 58307662) has the molecular formula C24H18O10 and a molecular weight of 466.40 g/mol. Its IUPAC name is (10S)-10-(3,4-dihydroxycyclohexa-2,4-dien-1-yl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-10-(3,4-dihydroxycyclohexa-2,4-dien-1-yl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 58307662 |
| Molecular Formula | C24H18O10 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | (10S)-10-(3,4-dihydroxycyclohexa-2,4-dien-1-yl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@@H](C2C=C(O)C(O)=CC2)c2c(cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc23)O1 |
| InChI | InChI=1S/C24H18O10/c25-12-3-1-9(5-14(12)27)11-7-18(30)33-17-8-16(29)20-21(31)22(32)23(34-24(20)19(11)17)10-2-4-13(26)15(28)6-10/h2-6,8-9,11,25-29,32H,1,7H2/t9?,11-/m0/s1 |
| InChIKey | JCEFRPJQZYOAEY-UMJHXOGRSA-N |
| XLogP | 3.58 |
| TPSA | 177.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|