C27H20O12 — CID 91637040
2-[4-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]-2-methoxyphenoxy]acetic acid (PubChem CID 91637040) has the molecular formula C27H20O12 and a molecular weight of 536.45 g/mol. Its IUPAC name is 2-[4-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 91637040 |
| Molecular Formula | C27H20O12 |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 2-[4-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)ccc1OCC(=O)O |
| InChI | InChI=1S/C27H20O12/c1-36-18-7-11(3-5-17(18)37-10-20(31)32)13-8-21(33)38-19-9-16(30)23-24(34)25(35)26(39-27(23)22(13)19)12-2-4-14(28)15(29)6-12/h2-7,9,13,28-30,35H,8,10H2,1H3,(H,31,32) |
| InChIKey | ZSPWPLPJOYCJTP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 193.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|