C34H28O10 — CID 71825726
2-(3,4-dihydroxyphenyl)-5-hydroxy-10-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71825726) has the molecular formula C34H28O10 and a molecular weight of 596.59 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-10-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-10-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71825726 |
| Molecular Formula | C34H28O10 |
| Molecular Weight | 596.59 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-10-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(CCOc2c(OC)cccc2C2CC(=O)Oc3cc(O)c4c(=O)cc(-c5ccc(O)c(O)c5)oc4c32)cc1 |
| InChI | InChI=1S/C34H28O10/c1-40-20-9-6-18(7-10-20)12-13-42-33-21(4-3-5-27(33)41-2)22-15-30(39)43-29-17-26(38)32-25(37)16-28(44-34(32)31(22)29)19-8-11-23(35)24(36)14-19/h3-11,14,16-17,22,35-36,38H,12-13,15H2,1-2H3 |
| InChIKey | VRLHVIVWHPGRFY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|