C33H26O8 — CID 98885051
(10R)-5,6-dihydroxy-10-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 98885051) has the molecular formula C33H26O8 and a molecular weight of 550.56 g/mol. Its IUPAC name is (10R)-5,6-dihydroxy-10-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-5,6-dihydroxy-10-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 98885051 |
| Molecular Formula | C33H26O8 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | (10R)-5,6-dihydroxy-10-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(CCOc2ccccc2[C@H]2CC(=O)Oc3c(O)c(O)c4c(=O)cc(-c5ccccc5)oc4c32)cc1 |
| InChI | InChI=1S/C33H26O8/c1-38-21-13-11-19(12-14-21)15-16-39-25-10-6-5-9-22(25)23-17-27(35)41-33-28(23)32-29(30(36)31(33)37)24(34)18-26(40-32)20-7-3-2-4-8-20/h2-14,18,23,36-37H,15-17H2,1H3/t23-/m1/s1 |
| InChIKey | UEKYBLGEGGFLEF-HSZRJFAPSA-N |
| XLogP | 5.94 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|