C34H28O6 — CID 110207822
4-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione (PubChem CID 110207822) has the molecular formula C34H28O6 and a molecular weight of 532.59 g/mol. Its IUPAC name is 4-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione.
| Compound Name | 4-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
|---|---|
| PubChem CID | 110207822 |
| Molecular Formula | C34H28O6 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 4-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
| SMILES | COc1ccc(CCOc2ccccc2C2CC(=O)Oc3c2c(C)cc2oc(=O)cc(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C34H28O6/c1-21-18-29-33(26(19-30(35)39-29)23-8-4-3-5-9-23)34-32(21)27(20-31(36)40-34)25-10-6-7-11-28(25)38-17-16-22-12-14-24(37-2)15-13-22/h3-15,18-19,27H,16-17,20H2,1-2H3 |
| InChIKey | FDIKIJKIBWSESC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|