C32H28O6 — CID 125123083
(6S)-6-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-8-methyl-3,11-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),8,13(17)-tetraene-4,12-dione (PubChem CID 125123083) has the molecular formula C32H28O6 and a molecular weight of 508.57 g/mol. Its IUPAC name is (6S)-6-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-8-methyl-3,11-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),8,13(17)-tetraene-4,12-dione.
| Compound Name | (6S)-6-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-8-methyl-3,11-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),8,13(17)-tetraene-4,12-dione |
|---|---|
| PubChem CID | 125123083 |
| Molecular Formula | C32H28O6 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (6S)-6-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-8-methyl-3,11-dioxatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),8,13(17)-tetraene-4,12-dione |
| SMILES | Cc1cc2oc(=O)c3c(c2c2c1[C@H](c1ccccc1OCCc1ccc4c(c1)CCO4)CC(=O)O2)CCC3 |
| InChI | InChI=1S/C32H28O6/c1-18-15-27-30(22-6-4-7-23(22)32(34)37-27)31-29(18)24(17-28(33)38-31)21-5-2-3-8-26(21)36-13-11-19-9-10-25-20(16-19)12-14-35-25/h2-3,5,8-10,15-16,24H,4,6-7,11-14,17H2,1H3/t24-/m0/s1 |
| InChIKey | VBOQGTKPCRFTLH-DEOSSOPVSA-N |
| XLogP | 5.59 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|