C36H30O8 — CID 163089379
9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163089379) has the molecular formula C36H30O8 and a molecular weight of 590.63 g/mol. Its IUPAC name is 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163089379 |
| Molecular Formula | C36H30O8 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(C=C2Oc3c(ccc4c3C(c3cccc(OC)c3OCCc3ccc5c(c3)CCO5)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C36H30O8/c1-39-24-9-6-21(7-10-24)19-31-34(38)26-11-13-29-33(36(26)44-31)27(20-32(37)43-29)25-4-3-5-30(40-2)35(25)42-16-14-22-8-12-28-23(18-22)15-17-41-28/h3-13,18-19,27H,14-17,20H2,1-2H3 |
| InChIKey | UHVNGFMVRAAZOP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|