C35H30O8 — CID 99993684
(2Z,9R)-9-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 99993684) has the molecular formula C35H30O8 and a molecular weight of 578.62 g/mol. Its IUPAC name is (2Z,9R)-9-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 99993684 |
| Molecular Formula | C35H30O8 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | (2Z,9R)-9-[3-methoxy-2-[2-(4-methoxyphenyl)ethoxy]phenyl]-2-[(4-methoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3[C@@H](c3cccc(OC)c3OCCc3ccc(OC)cc3)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C35H30O8/c1-38-23-11-7-21(8-12-23)17-18-41-34-25(5-4-6-29(34)40-3)27-20-31(36)42-28-16-15-26-33(37)30(43-35(26)32(27)28)19-22-9-13-24(39-2)14-10-22/h4-16,19,27H,17-18,20H2,1-3H3/b30-19-/t27-/m1/s1 |
| InChIKey | RYQDEFPSGSLRKS-LJAKKAIASA-N |
| XLogP | 6.39 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|