C33H26O6 — CID 162945458
2-benzylidene-9-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 162945458) has the molecular formula C33H26O6 and a molecular weight of 518.57 g/mol. Its IUPAC name is 2-benzylidene-9-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 2-benzylidene-9-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 162945458 |
| Molecular Formula | C33H26O6 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 2-benzylidene-9-[2-[2-(4-methoxyphenyl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(CCOc2ccccc2C2CC(=O)Oc3ccc4c(c32)OC(=Cc2ccccc2)C4=O)cc1 |
| InChI | InChI=1S/C33H26O6/c1-36-23-13-11-21(12-14-23)17-18-37-27-10-6-5-9-24(27)26-20-30(34)38-28-16-15-25-32(35)29(39-33(25)31(26)28)19-22-7-3-2-4-8-22/h2-16,19,26H,17-18,20H2,1H3 |
| InChIKey | RCKVHVSVSXHFLH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|