C34H26O6 — CID 124879545
(2Z,9R)-2-benzylidene-9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124879545) has the molecular formula C34H26O6 and a molecular weight of 530.58 g/mol. Its IUPAC name is (2Z,9R)-2-benzylidene-9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-2-benzylidene-9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124879545 |
| Molecular Formula | C34H26O6 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (2Z,9R)-2-benzylidene-9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]phenyl]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1C[C@H](c2ccccc2OCCc2ccc3c(c2)CCO3)c2c(ccc3c2O/C(=C\c2ccccc2)C3=O)O1 |
| InChI | InChI=1S/C34H26O6/c35-31-20-26(24-8-4-5-9-28(24)38-16-14-22-10-12-27-23(18-22)15-17-37-27)32-29(39-31)13-11-25-33(36)30(40-34(25)32)19-21-6-2-1-3-7-21/h1-13,18-19,26H,14-17,20H2/b30-19-/t26-/m1/s1 |
| InChIKey | ULSLKBBEHSPZGM-KAECXJSPSA-N |
| XLogP | 6.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|