C33H26O8 — CID 124877511
(2Z,9S)-9-[4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-(furan-2-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124877511) has the molecular formula C33H26O8 and a molecular weight of 550.56 g/mol. Its IUPAC name is (2Z,9S)-9-[4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-(furan-2-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-9-[4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-(furan-2-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124877511 |
| Molecular Formula | C33H26O8 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | (2Z,9S)-9-[4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-(furan-2-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cc([C@@H]2CC(=O)Oc3ccc4c(c32)O/C(=C\c2ccco2)C4=O)ccc1OCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C33H26O8/c1-36-28-16-20(5-8-26(28)39-13-10-19-4-7-25-21(15-19)11-14-38-25)24-18-30(34)40-27-9-6-23-32(35)29(41-33(23)31(24)27)17-22-3-2-12-37-22/h2-9,12,15-17,24H,10-11,13-14,18H2,1H3/b29-17-/t24-/m0/s1 |
| InChIKey | IKNIQWSXJGDUNE-WYDFGVIMSA-N |
| XLogP | 5.90 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|