C38H34O10 — CID 162931179
9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 162931179) has the molecular formula C38H34O10 and a molecular weight of 650.68 g/mol. Its IUPAC name is 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 162931179 |
| Molecular Formula | C38H34O10 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | 9-[2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cc(OC)c(OC)cc1C=C1Oc2c(ccc3c2C(c2cccc(OC)c2OCCc2ccc4c(c2)CCO4)CC(=O)O3)C1=O |
| InChI | InChI=1S/C38H34O10/c1-41-29-7-5-6-24(37(29)46-14-12-21-8-10-27-22(16-21)13-15-45-27)26-19-34(39)47-28-11-9-25-36(40)33(48-38(25)35(26)28)18-23-17-31(43-3)32(44-4)20-30(23)42-2/h5-11,16-18,20,26H,12-15,19H2,1-4H3 |
| InChIKey | XTTOMBYAQMXJSD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|