C28H22O7 — CID 110206398
4-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione (PubChem CID 110206398) has the molecular formula C28H22O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is 4-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione.
| Compound Name | 4-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
|---|---|
| PubChem CID | 110206398 |
| Molecular Formula | C28H22O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 4-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
| SMILES | COc1cc(C2CC(=O)Oc3c2c(C)cc2oc(=O)cc(-c4ccccc4)c32)cc2c1OCCO2 |
| InChI | InChI=1S/C28H22O7/c1-15-10-20-26(18(13-23(29)34-20)16-6-4-3-5-7-16)28-25(15)19(14-24(30)35-28)17-11-21(31-2)27-22(12-17)32-8-9-33-27/h3-7,10-13,19H,8-9,14H2,1-2H3 |
| InChIKey | USHWMRDYNNCMLS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|