C26H18O6 — CID 124876785
(4S)-4-(1,3-benzodioxol-5-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione (PubChem CID 124876785) has the molecular formula C26H18O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is (4S)-4-(1,3-benzodioxol-5-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione.
| Compound Name | (4S)-4-(1,3-benzodioxol-5-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
|---|---|
| PubChem CID | 124876785 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (4S)-4-(1,3-benzodioxol-5-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
| SMILES | Cc1cc2oc(=O)cc(-c3ccccc3)c2c2c1[C@H](c1ccc3c(c1)OCO3)CC(=O)O2 |
| InChI | InChI=1S/C26H18O6/c1-14-9-21-25(17(11-22(27)31-21)15-5-3-2-4-6-15)26-24(14)18(12-23(28)32-26)16-7-8-19-20(10-16)30-13-29-19/h2-11,18H,12-13H2,1H3/t18-/m0/s1 |
| InChIKey | HBPTZVVZNRXIEH-SFHVURJKSA-N |
| XLogP | 4.94 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|