C27H20O7 — CID 124879339
(4R)-4-(7-methoxy-1,3-benzodioxol-5-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione (PubChem CID 124879339) has the molecular formula C27H20O7 and a molecular weight of 456.45 g/mol. Its IUPAC name is (4R)-4-(7-methoxy-1,3-benzodioxol-5-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione.
| Compound Name | (4R)-4-(7-methoxy-1,3-benzodioxol-5-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
|---|---|
| PubChem CID | 124879339 |
| Molecular Formula | C27H20O7 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (4R)-4-(7-methoxy-1,3-benzodioxol-5-yl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
| SMILES | COc1cc([C@H]2CC(=O)Oc3c2c(C)cc2oc(=O)cc(-c4ccccc4)c32)cc2c1OCO2 |
| InChI | InChI=1S/C27H20O7/c1-14-8-19-25(17(11-22(28)33-19)15-6-4-3-5-7-15)27-24(14)18(12-23(29)34-27)16-9-20(30-2)26-21(10-16)31-13-32-26/h3-11,18H,12-13H2,1-2H3/t18-/m1/s1 |
| InChIKey | RXWXRCNGGHBPRA-GOSISDBHSA-N |
| XLogP | 4.95 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|