C27H22O6 — CID 110206029
4-(3,4-dimethoxyphenyl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione (PubChem CID 110206029) has the molecular formula C27H22O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione.
| Compound Name | 4-(3,4-dimethoxyphenyl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
|---|---|
| PubChem CID | 110206029 |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-5-methyl-10-phenyl-3,4-dihydropyrano[2,3-h]chromene-2,8-dione |
| SMILES | COc1ccc(C2CC(=O)Oc3c2c(C)cc2oc(=O)cc(-c4ccccc4)c32)cc1OC |
| InChI | InChI=1S/C27H22O6/c1-15-11-22-26(18(13-23(28)32-22)16-7-5-4-6-8-16)27-25(15)19(14-24(29)33-27)17-9-10-20(30-2)21(12-17)31-3/h4-13,19H,14H2,1-3H3 |
| InChIKey | AGTFYFKVYOAGKH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|