C21H16O8 — CID 99996426
2-[4-[(4S)-2,5-dioxo-3,4-dihydropyrano[3,2-c]chromen-4-yl]-2-methoxyphenoxy]acetic acid (PubChem CID 99996426) has the molecular formula C21H16O8 and a molecular weight of 396.35 g/mol. Its IUPAC name is 2-[4-[(4S)-2,5-dioxo-3,4-dihydropyrano[3,2-c]chromen-4-yl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(4S)-2,5-dioxo-3,4-dihydropyrano[3,2-c]chromen-4-yl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 99996426 |
| Molecular Formula | C21H16O8 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[4-[(4S)-2,5-dioxo-3,4-dihydropyrano[3,2-c]chromen-4-yl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc([C@@H]2CC(=O)Oc3c2c(=O)oc2ccccc32)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H16O8/c1-26-16-8-11(6-7-15(16)27-10-17(22)23)13-9-18(24)29-20-12-4-2-3-5-14(12)28-21(25)19(13)20/h2-8,13H,9-10H2,1H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | VHNSWJFYSRONMX-ZDUSSCGKSA-N |
| XLogP | 2.71 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|