C20H20O7 — CID 20993736
2-[[4-(4-ethoxy-3-methoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid (PubChem CID 20993736) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-[[4-(4-ethoxy-3-methoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid.
| Compound Name | 2-[[4-(4-ethoxy-3-methoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 20993736 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[[4-(4-ethoxy-3-methoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid |
| SMILES | CCOc1ccc(C2CC(=O)Oc3cc(OCC(=O)O)ccc32)cc1OC |
| InChI | InChI=1S/C20H20O7/c1-3-25-16-7-4-12(8-18(16)24-2)15-10-20(23)27-17-9-13(5-6-14(15)17)26-11-19(21)22/h4-9,15H,3,10-11H2,1-2H3,(H,21,22) |
| InChIKey | MLHYECOOXMRFMM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|