C21H22O7 — CID 22686076
2-[[4-(3-methoxy-4-propoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid (PubChem CID 22686076) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[[4-(3-methoxy-4-propoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid.
| Compound Name | 2-[[4-(3-methoxy-4-propoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 22686076 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[[4-(3-methoxy-4-propoxyphenyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]acetic acid |
| SMILES | CCCOc1ccc(C2CC(=O)Oc3cc(OCC(=O)O)ccc32)cc1OC |
| InChI | InChI=1S/C21H22O7/c1-3-8-26-17-7-4-13(9-19(17)25-2)16-11-21(24)28-18-10-14(5-6-15(16)18)27-12-20(22)23/h4-7,9-10,16H,3,8,11-12H2,1-2H3,(H,22,23) |
| InChIKey | VCVMYEYZHOLKAS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|