C25H22O6 — CID 99994988
(8R)-8-[3-methoxy-4-(2-phenylethoxy)phenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one (PubChem CID 99994988) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is (8R)-8-[3-methoxy-4-(2-phenylethoxy)phenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one.
| Compound Name | (8R)-8-[3-methoxy-4-(2-phenylethoxy)phenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
|---|---|
| PubChem CID | 99994988 |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (8R)-8-[3-methoxy-4-(2-phenylethoxy)phenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
| SMILES | COc1cc([C@H]2CC(=O)Oc3cc4c(cc32)OCO4)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C25H22O6/c1-27-22-11-17(7-8-20(22)28-10-9-16-5-3-2-4-6-16)18-13-25(26)31-21-14-24-23(12-19(18)21)29-15-30-24/h2-8,11-12,14,18H,9-10,13,15H2,1H3/t18-/m1/s1 |
| InChIKey | XPEZLCUFVDNMRT-GOSISDBHSA-N |
| XLogP | 4.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|