C17H18O4 — CID 145124096
4-(4-hydroxy-3-methoxyphenyl)-3,4-dihydrochromen-2-one;methane (PubChem CID 145124096) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-(4-hydroxy-3-methoxyphenyl)-3,4-dihydrochromen-2-one;methane.
| Compound Name | 4-(4-hydroxy-3-methoxyphenyl)-3,4-dihydrochromen-2-one;methane |
|---|---|
| PubChem CID | 145124096 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-(4-hydroxy-3-methoxyphenyl)-3,4-dihydrochromen-2-one;methane |
| SMILES | C.COc1cc(C2CC(=O)Oc3ccccc32)ccc1O |
| InChI | InChI=1S/C16H14O4.CH4/c1-19-15-8-10(6-7-13(15)17)12-9-16(18)20-14-5-3-2-4-11(12)14;/h2-8,12,17H,9H2,1H3;1H4 |
| InChIKey | NWTSBKSCSHFHEH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|