C17H16O5 — CID 166157644
(4R)-7-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-6-methyl-3,4-dihydrochromen-2-one (PubChem CID 166157644) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is (4R)-7-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-6-methyl-3,4-dihydrochromen-2-one.
| Compound Name | (4R)-7-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-6-methyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 166157644 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (4R)-7-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-6-methyl-3,4-dihydrochromen-2-one |
| SMILES | COc1cc([C@H]2CC(=O)Oc3cc(O)c(C)cc32)ccc1O |
| InChI | InChI=1S/C17H16O5/c1-9-5-12-11(7-17(20)22-15(12)8-14(9)19)10-3-4-13(18)16(6-10)21-2/h3-6,8,11,18-19H,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | JRKUGARVPLRXKK-LLVKDONJSA-N |
| XLogP | 2.86 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|