C19H20O7 — CID 102564866
4-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-3,4-dihydrochromen-2-one (PubChem CID 102564866) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is 4-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-3,4-dihydrochromen-2-one.
| Compound Name | 4-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 102564866 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-3,4-dihydrochromen-2-one |
| SMILES | COc1ccc(C2CC(=O)Oc3cc(OC)c(OC)c(OC)c32)cc1O |
| InChI | InChI=1S/C19H20O7/c1-22-13-6-5-10(7-12(13)20)11-8-16(21)26-14-9-15(23-2)18(24-3)19(25-4)17(11)14/h5-7,9,11,20H,8H2,1-4H3 |
| InChIKey | MYAPCOFAPVSUBD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|