C20H18N2O5 — CID 99998264
(4R)-5,6,7-trimethoxy-4-quinoxalin-6-yl-3,4-dihydrochromen-2-one (PubChem CID 99998264) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (4R)-5,6,7-trimethoxy-4-quinoxalin-6-yl-3,4-dihydrochromen-2-one.
| Compound Name | (4R)-5,6,7-trimethoxy-4-quinoxalin-6-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 99998264 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (4R)-5,6,7-trimethoxy-4-quinoxalin-6-yl-3,4-dihydrochromen-2-one |
| SMILES | COc1cc2c(c(OC)c1OC)[C@@H](c1ccc3nccnc3c1)CC(=O)O2 |
| InChI | InChI=1S/C20H18N2O5/c1-24-16-10-15-18(20(26-3)19(16)25-2)12(9-17(23)27-15)11-4-5-13-14(8-11)22-7-6-21-13/h4-8,10,12H,9H2,1-3H3/t12-/m1/s1 |
| InChIKey | AIKQHRVWTCCBKA-GFCCVEGCSA-N |
| XLogP | 3.10 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|