C18H16N2O5S — CID 97489387
(9R)-9-(3,4,5-trimethoxyphenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one (PubChem CID 97489387) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is (9R)-9-(3,4,5-trimethoxyphenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one.
| Compound Name | (9R)-9-(3,4,5-trimethoxyphenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one |
|---|---|
| PubChem CID | 97489387 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (9R)-9-(3,4,5-trimethoxyphenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one |
| SMILES | COc1cc([C@H]2CC(=O)Oc3ccc4nsnc4c32)cc(OC)c1OC |
| InChI | InChI=1S/C18H16N2O5S/c1-22-13-6-9(7-14(23-2)18(13)24-3)10-8-15(21)25-12-5-4-11-17(16(10)12)20-26-19-11/h4-7,10H,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | HSRIPBZOPRSYBS-SNVBAGLBSA-N |
| XLogP | 3.16 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|