C17H14N2O5S — CID 75490333
9-(4-hydroxy-3,5-dimethoxyphenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one (PubChem CID 75490333) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 9-(4-hydroxy-3,5-dimethoxyphenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one.
| Compound Name | 9-(4-hydroxy-3,5-dimethoxyphenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one |
|---|---|
| PubChem CID | 75490333 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 9-(4-hydroxy-3,5-dimethoxyphenyl)-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-7-one |
| SMILES | COc1cc(C2CC(=O)Oc3ccc4nsnc4c32)cc(OC)c1O |
| InChI | InChI=1S/C17H14N2O5S/c1-22-12-5-8(6-13(23-2)17(12)21)9-7-14(20)24-11-4-3-10-16(15(9)11)19-25-18-10/h3-6,9,21H,7H2,1-2H3 |
| InChIKey | GPENIVXTWCPWQX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|