C18H18O5 — CID 6540146
(4S)-5,7-dimethoxy-4-(4-methoxyphenyl)-3,4-dihydrochromen-2-one (PubChem CID 6540146) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (4S)-5,7-dimethoxy-4-(4-methoxyphenyl)-3,4-dihydrochromen-2-one.
| Compound Name | (4S)-5,7-dimethoxy-4-(4-methoxyphenyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 6540146 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (4S)-5,7-dimethoxy-4-(4-methoxyphenyl)-3,4-dihydrochromen-2-one |
| SMILES | COc1ccc([C@@H]2CC(=O)Oc3cc(OC)cc(OC)c32)cc1 |
| InChI | InChI=1S/C18H18O5/c1-20-12-6-4-11(5-7-12)14-10-17(19)23-16-9-13(21-2)8-15(22-3)18(14)16/h4-9,14H,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | COOUEGPUMYEYNP-AWEZNQCLSA-N |
| XLogP | 3.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|