C17H16O4 — CID 102427491
7-hydroxy-4-(4-methoxyphenyl)-5-methyl-3,4-dihydrochromen-2-one (PubChem CID 102427491) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 7-hydroxy-4-(4-methoxyphenyl)-5-methyl-3,4-dihydrochromen-2-one.
| Compound Name | 7-hydroxy-4-(4-methoxyphenyl)-5-methyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 102427491 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 7-hydroxy-4-(4-methoxyphenyl)-5-methyl-3,4-dihydrochromen-2-one |
| SMILES | COc1ccc(C2CC(=O)Oc3cc(O)cc(C)c32)cc1 |
| InChI | InChI=1S/C17H16O4/c1-10-7-12(18)8-15-17(10)14(9-16(19)21-15)11-3-5-13(20-2)6-4-11/h3-8,14,18H,9H2,1-2H3 |
| InChIKey | UVFHONNEQXUTIS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|