C25H20O7 — CID 42607961
5-hydroxy-4-(4-hydroxyphenyl)-8-(4-methoxyphenyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromene-2,6-dione (PubChem CID 42607961) has the molecular formula C25H20O7 and a molecular weight of 432.43 g/mol. Its IUPAC name is 5-hydroxy-4-(4-hydroxyphenyl)-8-(4-methoxyphenyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromene-2,6-dione.
| Compound Name | 5-hydroxy-4-(4-hydroxyphenyl)-8-(4-methoxyphenyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromene-2,6-dione |
|---|---|
| PubChem CID | 42607961 |
| Molecular Formula | C25H20O7 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 5-hydroxy-4-(4-hydroxyphenyl)-8-(4-methoxyphenyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromene-2,6-dione |
| SMILES | COc1ccc(C2CC(=O)c3c(cc4c(c3O)C(c3ccc(O)cc3)CC(=O)O4)O2)cc1 |
| InChI | InChI=1S/C25H20O7/c1-30-16-8-4-14(5-9-16)19-11-18(27)24-21(31-19)12-20-23(25(24)29)17(10-22(28)32-20)13-2-6-15(26)7-3-13/h2-9,12,17,19,26,29H,10-11H2,1H3 |
| InChIKey | DNOIKCRYNMLUFP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|