C24H18O7 — CID 163019893
(4S,8R)-5-hydroxy-4,8-bis(4-hydroxyphenyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromene-2,6-dione (PubChem CID 163019893) has the molecular formula C24H18O7 and a molecular weight of 418.40 g/mol. Its IUPAC name is (4S,8R)-5-hydroxy-4,8-bis(4-hydroxyphenyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromene-2,6-dione.
| Compound Name | (4S,8R)-5-hydroxy-4,8-bis(4-hydroxyphenyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromene-2,6-dione |
|---|---|
| PubChem CID | 163019893 |
| Molecular Formula | C24H18O7 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (4S,8R)-5-hydroxy-4,8-bis(4-hydroxyphenyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromene-2,6-dione |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)c2c(cc3c(c2O)C(=O)C[C@H](c2ccc(O)cc2)O3)O1 |
| InChI | InChI=1S/C24H18O7/c25-14-5-1-12(2-6-14)16-9-21(28)31-19-11-20-23(24(29)22(16)19)17(27)10-18(30-20)13-3-7-15(26)8-4-13/h1-8,11,16,18,25-26,29H,9-10H2/t16-,18+/m0/s1 |
| InChIKey | BRPIOKDBXKCDNY-FUHWJXTLSA-N |
| XLogP | 3.95 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|