C24H20O8 — CID 162905454
(2S,3S,10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-hydroxyphenyl)-3,4,9,10-tetrahydro-2H-pyrano[2,3-f]chromen-8-one (PubChem CID 162905454) has the molecular formula C24H20O8 and a molecular weight of 436.42 g/mol. Its IUPAC name is (2S,3S,10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-hydroxyphenyl)-3,4,9,10-tetrahydro-2H-pyrano[2,3-f]chromen-8-one.
| Compound Name | (2S,3S,10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-hydroxyphenyl)-3,4,9,10-tetrahydro-2H-pyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 162905454 |
| Molecular Formula | C24H20O8 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (2S,3S,10S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-hydroxyphenyl)-3,4,9,10-tetrahydro-2H-pyrano[2,3-f]chromen-8-one |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)c2c(cc(O)c3c2O[C@@H](c2ccc(O)c(O)c2)[C@@H](O)C3)O1 |
| InChI | InChI=1S/C24H20O8/c25-13-4-1-11(2-5-13)14-9-21(30)31-20-10-17(27)15-8-19(29)23(32-24(15)22(14)20)12-3-6-16(26)18(28)7-12/h1-7,10,14,19,23,25-29H,8-9H2/t14-,19-,23-/m0/s1 |
| InChIKey | NHAIWTJLRMSZKP-FAHJTYSBSA-N |
| XLogP | 2.99 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|