C31H28O11 — CID 3485811
10-(2,4-dihydroxyphenyl)-8-(3,4-dihydroxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-2,3,4,8,9,10-hexahydropyrano[2,3-f]chromene-3,5,9-triol (PubChem CID 3485811) has the molecular formula C31H28O11 and a molecular weight of 576.55 g/mol. Its IUPAC name is 10-(2,4-dihydroxyphenyl)-8-(3,4-dihydroxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-2,3,4,8,9,10-hexahydropyrano[2,3-f]chromene-3,5,9-triol.
| Compound Name | 10-(2,4-dihydroxyphenyl)-8-(3,4-dihydroxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-2,3,4,8,9,10-hexahydropyrano[2,3-f]chromene-3,5,9-triol |
|---|---|
| PubChem CID | 3485811 |
| Molecular Formula | C31H28O11 |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 10-(2,4-dihydroxyphenyl)-8-(3,4-dihydroxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-2,3,4,8,9,10-hexahydropyrano[2,3-f]chromene-3,5,9-triol |
| SMILES | COc1ccc(C2Oc3c(c(O)cc4c3C(c3ccc(O)cc3O)C(O)C(c3ccc(O)c(O)c3)O4)CC2O)cc1O |
| InChI | InChI=1S/C31H28O11/c1-40-24-7-3-13(9-22(24)37)29-23(38)11-17-20(35)12-25-27(31(17)42-29)26(16-5-4-15(32)10-19(16)34)28(39)30(41-25)14-2-6-18(33)21(36)8-14/h2-10,12,23,26,28-30,32-39H,11H2,1H3 |
| InChIKey | SZFJUXKCFZRGQY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|