C34H36O12 — CID 143805456
(2R)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-7-methoxy-3,4-dihydro-2H-chromene-3,5-diol;ethane (PubChem CID 143805456) has the molecular formula C34H36O12 and a molecular weight of 636.65 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-7-methoxy-3,4-dihydro-2H-chromene-3,5-diol;ethane.
| Compound Name | (2R)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-7-methoxy-3,4-dihydro-2H-chromene-3,5-diol;ethane |
|---|---|
| PubChem CID | 143805456 |
| Molecular Formula | C34H36O12 |
| Molecular Weight | 636.65 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | (2R)-2-(3,4-dihydroxyphenyl)-8-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-7-methoxy-3,4-dihydro-2H-chromene-3,5-diol;ethane |
| SMILES | CC.COc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2c1c(OC)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)C(O)C2 |
| InChI | InChI=1S/C32H30O12.C2H6/c1-41-15-9-22(38)26-25(10-15)43-31(14-4-6-18(34)21(37)8-14)29(40)28(26)27-24(42-2)12-19(35)16-11-23(39)30(44-32(16)27)13-3-5-17(33)20(36)7-13;1-2/h3-10,12,23,28-31,33-40H,11H2,1-2H3;1-2H3/t23?,28?,29-,30-,31-;/m1./s1 |
| InChIKey | CNMRHZGNHOWCPH-BREIPUETSA-N |
| XLogP | 4.63 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|