C24H24O9 — CID 10599886
(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-(2,4,6-trimethoxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 10599886) has the molecular formula C24H24O9 and a molecular weight of 456.45 g/mol. Its IUPAC name is (2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-(2,4,6-trimethoxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-(2,4,6-trimethoxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 10599886 |
| Molecular Formula | C24H24O9 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-(2,4,6-trimethoxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | COc1cc(OC)c([C@@H]2c3c(O)cc(O)cc3O[C@H](c3ccc(O)c(O)c3)[C@@H]2O)c(OC)c1 |
| InChI | InChI=1S/C24H24O9/c1-30-13-9-17(31-2)21(18(10-13)32-3)22-20-16(28)7-12(25)8-19(20)33-24(23(22)29)11-4-5-14(26)15(27)6-11/h4-10,22-29H,1-3H3/t22-,23+,24+/m0/s1 |
| InChIKey | OHAKBDIONGFIDJ-RBZQAINGSA-N |
| XLogP | 3.16 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|