C27H27NO10 — CID 77479160
methyl 2-[5-[4-(2-amino-4,6-dimethoxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]-1,3-benzodioxol-2-yl]acetate (PubChem CID 77479160) has the molecular formula C27H27NO10 and a molecular weight of 525.51 g/mol. Its IUPAC name is methyl 2-[5-[4-(2-amino-4,6-dimethoxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]-1,3-benzodioxol-2-yl]acetate.
| Compound Name | methyl 2-[5-[4-(2-amino-4,6-dimethoxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]-1,3-benzodioxol-2-yl]acetate |
|---|---|
| PubChem CID | 77479160 |
| Molecular Formula | C27H27NO10 |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | methyl 2-[5-[4-(2-amino-4,6-dimethoxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]-1,3-benzodioxol-2-yl]acetate |
| SMILES | COC(=O)CC1Oc2ccc(C3Oc4cc(O)cc(O)c4C(c4c(N)cc(OC)cc4OC)C3O)cc2O1 |
| InChI | InChI=1S/C27H27NO10/c1-33-14-9-15(28)23(19(10-14)34-2)25-24-16(30)7-13(29)8-20(24)38-27(26(25)32)12-4-5-17-18(6-12)37-22(36-17)11-21(31)35-3/h4-10,22,25-27,29-30,32H,11,28H2,1-3H3 |
| InChIKey | CYGIPBZSAJLJCQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|