C33H30O13 — CID 163183159
methyl 2-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R,3R,4R)-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-4-yl]acetate (PubChem CID 163183159) has the molecular formula C33H30O13 and a molecular weight of 634.59 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R,3R,4R)-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-4-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R,3R,4R)-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-4-yl]acetate |
|---|---|
| PubChem CID | 163183159 |
| Molecular Formula | C33H30O13 |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | methyl 2-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R,3R,4R)-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1c2c(O)cc(O)c([C@H]3c4c(O)cc(O)cc4O[C@H](c4ccc(O)cc4)[C@@H]3O)c2O[C@H](c2ccc(O)c(O)c2)[C@@H]1O |
| InChI | InChI=1S/C33H30O13/c1-44-24(41)11-17-25-21(39)12-22(40)27(33(25)46-32(29(17)42)14-4-7-18(36)19(37)8-14)28-26-20(38)9-16(35)10-23(26)45-31(30(28)43)13-2-5-15(34)6-3-13/h2-10,12,17,28-32,34-40,42-43H,11H2,1H3/t17-,28+,29+,30+,31+,32+/m0/s1 |
| InChIKey | ZYIMRHHBQADTCD-GNHPCHHNSA-N |
| XLogP | 3.39 |
| TPSA | 226.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|