C30H26O11 — CID 162944279
(2R,3R,8R,9S,10R)-10-(2,4-dihydroxyphenyl)-2,8-bis(3,4-dihydroxyphenyl)-2,3,4,8,9,10-hexahydropyrano[2,3-f]chromene-3,5,9-triol (PubChem CID 162944279) has the molecular formula C30H26O11 and a molecular weight of 562.53 g/mol. Its IUPAC name is (2R,3R,8R,9S,10R)-10-(2,4-dihydroxyphenyl)-2,8-bis(3,4-dihydroxyphenyl)-2,3,4,8,9,10-hexahydropyrano[2,3-f]chromene-3,5,9-triol.
| Compound Name | (2R,3R,8R,9S,10R)-10-(2,4-dihydroxyphenyl)-2,8-bis(3,4-dihydroxyphenyl)-2,3,4,8,9,10-hexahydropyrano[2,3-f]chromene-3,5,9-triol |
|---|---|
| PubChem CID | 162944279 |
| Molecular Formula | C30H26O11 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | (2R,3R,8R,9S,10R)-10-(2,4-dihydroxyphenyl)-2,8-bis(3,4-dihydroxyphenyl)-2,3,4,8,9,10-hexahydropyrano[2,3-f]chromene-3,5,9-triol |
| SMILES | Oc1ccc([C@@H]2c3c(cc(O)c4c3O[C@H](c3ccc(O)c(O)c3)[C@H](O)C4)O[C@H](c3ccc(O)c(O)c3)[C@H]2O)c(O)c1 |
| InChI | InChI=1S/C30H26O11/c31-14-3-4-15(19(34)9-14)25-26-24(40-29(27(25)39)13-2-6-18(33)22(37)8-13)11-20(35)16-10-23(38)28(41-30(16)26)12-1-5-17(32)21(36)7-12/h1-9,11,23,25,27-29,31-39H,10H2/t23-,25-,27+,28-,29-/m1/s1 |
| InChIKey | AMVCEZYBLCNDSF-YLCNXTAQSA-N |
| XLogP | 3.29 |
| TPSA | 200.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|