C30H22O11 — CID 23872054
(5S,6R)-5-(3,4-dihydroxyphenyl)-6,9,17,19-tetrahydroxy-13-(4-hydroxyphenyl)-4,12,14-trioxapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaen-21-one (PubChem CID 23872054) has the molecular formula C30H22O11 and a molecular weight of 558.50 g/mol. Its IUPAC name is (5S,6R)-5-(3,4-dihydroxyphenyl)-6,9,17,19-tetrahydroxy-13-(4-hydroxyphenyl)-4,12,14-trioxapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaen-21-one.
| Compound Name | (5S,6R)-5-(3,4-dihydroxyphenyl)-6,9,17,19-tetrahydroxy-13-(4-hydroxyphenyl)-4,12,14-trioxapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaen-21-one |
|---|---|
| PubChem CID | 23872054 |
| Molecular Formula | C30H22O11 |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | (5S,6R)-5-(3,4-dihydroxyphenyl)-6,9,17,19-tetrahydroxy-13-(4-hydroxyphenyl)-4,12,14-trioxapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaen-21-one |
| SMILES | O=C1c2c(O)cc(O)cc2OC2(c3ccc(O)cc3)Oc3cc(O)c4c(c3C12)O[C@@H](c1ccc(O)c(O)c1)[C@H](O)C4 |
| InChI | InChI=1S/C30H22O11/c31-14-4-2-13(3-5-14)30-26(27(38)24-20(36)8-15(32)9-22(24)40-30)25-23(41-30)11-18(34)16-10-21(37)28(39-29(16)25)12-1-6-17(33)19(35)7-12/h1-9,11,21,26,28,31-37H,10H2/t21-,26?,28+,30?/m1/s1 |
| InChIKey | GPKUBWUYEKQCMG-CGYWWSOSSA-N |
| XLogP | 3.56 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|