C30H22O11 — CID 100854539
(2S,2'R,3'S,8'S)-3',4,5',6,8'-pentahydroxy-2',8'-bis(4-hydroxyphenyl)spiro[1-benzofuran-2,9'-3,4-dihydro-2H-furo[2,3-h]chromene]-3-one (PubChem CID 100854539) has the molecular formula C30H22O11 and a molecular weight of 558.50 g/mol. Its IUPAC name is (2S,2'R,3'S,8'S)-3',4,5',6,8'-pentahydroxy-2',8'-bis(4-hydroxyphenyl)spiro[1-benzofuran-2,9'-3,4-dihydro-2H-furo[2,3-h]chromene]-3-one.
| Compound Name | (2S,2'R,3'S,8'S)-3',4,5',6,8'-pentahydroxy-2',8'-bis(4-hydroxyphenyl)spiro[1-benzofuran-2,9'-3,4-dihydro-2H-furo[2,3-h]chromene]-3-one |
|---|---|
| PubChem CID | 100854539 |
| Molecular Formula | C30H22O11 |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | (2S,2'R,3'S,8'S)-3',4,5',6,8'-pentahydroxy-2',8'-bis(4-hydroxyphenyl)spiro[1-benzofuran-2,9'-3,4-dihydro-2H-furo[2,3-h]chromene]-3-one |
| SMILES | O=C1c2c(O)cc(O)cc2O[C@@]12c1c(cc(O)c3c1O[C@H](c1ccc(O)cc1)[C@@H](O)C3)O[C@@]2(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H22O11/c31-15-5-1-13(2-6-15)26-21(36)11-18-19(34)12-23-25(27(18)39-26)29(30(38,41-23)14-3-7-16(32)8-4-14)28(37)24-20(35)9-17(33)10-22(24)40-29/h1-10,12,21,26,31-36,38H,11H2/t21-,26+,29-,30-/m0/s1 |
| InChIKey | PAUVEHXCLNBAPG-OJKOBIMHSA-N |
| XLogP | 2.96 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |