C19H20O6 — CID 6540077
(4S)-5,6,7-trimethoxy-4-(2-methoxyphenyl)-3,4-dihydrochromen-2-one (PubChem CID 6540077) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (4S)-5,6,7-trimethoxy-4-(2-methoxyphenyl)-3,4-dihydrochromen-2-one.
| Compound Name | (4S)-5,6,7-trimethoxy-4-(2-methoxyphenyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 6540077 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4S)-5,6,7-trimethoxy-4-(2-methoxyphenyl)-3,4-dihydrochromen-2-one |
| SMILES | COc1ccccc1[C@@H]1CC(=O)Oc2cc(OC)c(OC)c(OC)c21 |
| InChI | InChI=1S/C19H20O6/c1-21-13-8-6-5-7-11(13)12-9-16(20)25-14-10-15(22-2)18(23-3)19(24-4)17(12)14/h5-8,10,12H,9H2,1-4H3/t12-/m0/s1 |
| InChIKey | HCAAUFRAGZBANF-LBPRGKRZSA-N |
| XLogP | 3.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|